C16H24F2N4O — CID 111600901
1-[2-(2,5-difluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111600901) has the molecular formula C16H24F2N4O and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111600901 |
| Molecular Formula | C16H24F2N4O |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | N/C(=N\CCCN1CCOCC1)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H24F2N4O/c17-14-2-3-15(18)13(12-14)4-6-21-16(19)20-5-1-7-22-8-10-23-11-9-22/h2-3,12H,1,4-11H2,(H3,19,20,21) |
| InChIKey | WVZBUECJSLTNQJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|