C13H27N5O2 — CID 141003386
1,2-bis(2-morpholin-4-ylethyl)guanidine (PubChem CID 141003386) has the molecular formula C13H27N5O2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1,2-bis(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1,2-bis(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 141003386 |
| Molecular Formula | C13H27N5O2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 1,2-bis(2-morpholin-4-ylethyl)guanidine |
| SMILES | N/C(=N\CCN1CCOCC1)NCCN1CCOCC1 |
| InChI | InChI=1S/C13H27N5O2/c14-13(15-1-3-17-5-9-19-10-6-17)16-2-4-18-7-11-20-12-8-18/h1-12H2,(H3,14,15,16) |
| InChIKey | AERMNDFIVXNPEB-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|