C17H29N5OS — CID 111078805
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111078805) has the molecular formula C17H29N5OS and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111078805 |
| Molecular Formula | C17H29N5OS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | N/C(=N\CCCN1CCOCC1)NCCN1CCc2sccc2C1 |
| InChI | InChI=1S/C17H29N5OS/c18-17(19-4-1-6-21-9-11-23-12-10-21)20-5-8-22-7-2-16-15(14-22)3-13-24-16/h3,13H,1-2,4-12,14H2,(H3,18,19,20) |
| InChIKey | WWKJNVCEZGTGSJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|