C21H33N5O3 — CID 111975583
2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111975583) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111975583 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | COc1cc(OC)c2cc(CCC/N=C(\N)NCCCN3CCOCC3)[nH]c2c1 |
| InChI | InChI=1S/C21H33N5O3/c1-27-17-14-19-18(20(15-17)28-2)13-16(25-19)5-3-6-23-21(22)24-7-4-8-26-9-11-29-12-10-26/h13-15,25H,3-12H2,1-2H3,(H3,22,23,24) |
| InChIKey | MITJCGXBAFOKTJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|