C22H34IN5O4 — CID 111975528
ethyl 4-[[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111975528) has the molecular formula C22H34IN5O4 and a molecular weight of 559.45 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111975528 |
| Molecular Formula | C22H34IN5O4 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | ethyl 4-[[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCCc2cc3c(OC)cc(OC)cc3[nH]2)CC1.I |
| InChI | InChI=1S/C22H33N5O4.HI/c1-4-31-22(28)27-10-7-15(8-11-27)26-21(23)24-9-5-6-16-12-18-19(25-16)13-17(29-2)14-20(18)30-3;/h12-15,25H,4-11H2,1-3H3,(H3,23,24,26);1H |
| InChIKey | GGFBTKCCZSTFHB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|