C14H21IN4O2 — CID 111975101
2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111975101) has the molecular formula C14H21IN4O2 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111975101 |
| Molecular Formula | C14H21IN4O2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | COc1cc(OC)c2cc(CCCN=C(N)N)[nH]c2c1.I |
| InChI | InChI=1S/C14H20N4O2.HI/c1-19-10-7-12-11(13(8-10)20-2)6-9(18-12)4-3-5-17-14(15)16;/h6-8,18H,3-5H2,1-2H3,(H4,15,16,17);1H |
| InChIKey | ONEYPLNUVAUOER-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|