C18H28N4O2 — CID 111975112
2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1,3-diethylguanidine (PubChem CID 111975112) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1,3-diethylguanidine.
| Compound Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 111975112 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCCCc1cc2c(OC)cc(OC)cc2[nH]1)NCC |
| InChI | InChI=1S/C18H28N4O2/c1-5-19-18(20-6-2)21-9-7-8-13-10-15-16(22-13)11-14(23-3)12-17(15)24-4/h10-12,22H,5-9H2,1-4H3,(H2,19,20,21) |
| InChIKey | IHTHKIDVMCWQHR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|