C21H33IN4O2S — CID 109488132
N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488132) has the molecular formula C21H33IN4O2S and a molecular weight of 532.49 g/mol. Its IUPAC name is N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488132 |
| Molecular Formula | C21H33IN4O2S |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCCc1cc2c(OC)cc(OC)cc2[nH]1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C21H32N4O2S.HI/c1-21(2)14-25(9-10-28-21)20(22-3)23-8-6-7-15-11-17-18(24-15)12-16(26-4)13-19(17)27-5;/h11-13,24H,6-10,14H2,1-5H3,(H,22,23);1H |
| InChIKey | KKWNRWHLYPHCSM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|