C18H27N5S — CID 109488624
N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109488624) has the molecular formula C18H27N5S and a molecular weight of 345.52 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488624 |
| Molecular Formula | C18H27N5S |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C18H27N5S/c1-18(2)13-23(11-12-24-18)17(19-3)20-10-6-9-16-21-14-7-4-5-8-15(14)22-16/h4-5,7-8H,6,9-13H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | FFDMZQLUNJYBMF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|