C19H29N5 — CID 109453027
N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109453027) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453027 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCc1nc2ccccc2[nH]1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C19H29N5/c1-18(2)13-24(19(18,3)4)17(20-5)21-12-8-11-16-22-14-9-6-7-10-15(14)23-16/h6-7,9-10H,8,11-13H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | MQQUGMBOBZROGE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|