C22H27FN6 — CID 111164931
N-[3-(1H-benzimidazol-2-yl)propyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111164931) has the molecular formula C22H27FN6 and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111164931 |
| Molecular Formula | C22H27FN6 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H27FN6/c1-24-22(25-12-4-7-21-26-19-5-2-3-6-20(19)27-21)29-15-13-28(14-16-29)18-10-8-17(23)9-11-18/h2-3,5-6,8-11H,4,7,12-16H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | IMDQVZBABIMASV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|