C23H30IN5O2 — CID 111269294
N-[3-(1H-benzimidazol-2-yl)propyl]-6,7-dimethoxy-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111269294) has the molecular formula C23H30IN5O2 and a molecular weight of 535.43 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-6,7-dimethoxy-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-6,7-dimethoxy-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111269294 |
| Molecular Formula | C23H30IN5O2 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-6,7-dimethoxy-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc2ccccc2[nH]1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C23H29N5O2.HI/c1-24-23(25-11-6-9-22-26-18-7-4-5-8-19(18)27-22)28-12-10-16-13-20(29-2)21(30-3)14-17(16)15-28;/h4-5,7-8,13-14H,6,9-12,15H2,1-3H3,(H,24,25)(H,26,27);1H |
| InChIKey | SCYPRDHKWWDUOF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|