C21H28IN3O3 — CID 111268884
6,7-dimethoxy-N-[(2-methoxyphenyl)methyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111268884) has the molecular formula C21H28IN3O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 6,7-dimethoxy-N-[(2-methoxyphenyl)methyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | 6,7-dimethoxy-N-[(2-methoxyphenyl)methyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111268884 |
| Molecular Formula | C21H28IN3O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 6,7-dimethoxy-N-[(2-methoxyphenyl)methyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C21H27N3O3.HI/c1-22-21(23-13-16-7-5-6-8-18(16)25-2)24-10-9-15-11-19(26-3)20(27-4)12-17(15)14-24;/h5-8,11-12H,9-10,13-14H2,1-4H3,(H,22,23);1H |
| InChIKey | KKBJIWHWPTYIOB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|