C24H34IN3O5 — CID 111269024
6,7-dimethoxy-N'-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111269024) has the molecular formula C24H34IN3O5 and a molecular weight of 571.46 g/mol. Its IUPAC name is 6,7-dimethoxy-N'-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | 6,7-dimethoxy-N'-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111269024 |
| Molecular Formula | C24H34IN3O5 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 6,7-dimethoxy-N'-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)c(OC)c1OC)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C24H33N3O5.HI/c1-25-24(26-11-9-16-7-8-19(28-2)23(32-6)22(16)31-5)27-12-10-17-13-20(29-3)21(30-4)14-18(17)15-27;/h7-8,13-14H,9-12,15H2,1-6H3,(H,25,26);1H |
| InChIKey | IEGHYBYVNJHOQN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|