C22H29IN4O4 — CID 111269150
methyl N-[4-[[[C-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111269150) has the molecular formula C22H29IN4O4 and a molecular weight of 540.40 g/mol. Its IUPAC name is methyl N-[4-[[[C-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[C-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111269150 |
| Molecular Formula | C22H29IN4O4 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | methyl N-[4-[[[C-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)OC)cc1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C22H28N4O4.HI/c1-23-21(24-13-15-5-7-18(8-6-15)25-22(27)30-4)26-10-9-16-11-19(28-2)20(29-3)12-17(16)14-26;/h5-8,11-12H,9-10,13-14H2,1-4H3,(H,23,24)(H,25,27);1H |
| InChIKey | NSSQJRFANCOBCF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|