C21H36FIN6 — CID 111164936
4-(4-fluorophenyl)-N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111164936) has the molecular formula C21H36FIN6 and a molecular weight of 518.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111164936 |
| Molecular Formula | C21H36FIN6 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCN1CCN(C)CC1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C21H35FN6.HI/c1-23-21(24-9-3-4-10-26-13-11-25(2)12-14-26)28-17-15-27(16-18-28)20-7-5-19(22)6-8-20;/h5-8H,3-4,9-18H2,1-2H3,(H,23,24);1H |
| InChIKey | GPALZEJNXKFQKC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|