C16H21FN6 — CID 111165836
4-(4-fluorophenyl)-N'-methyl-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111165836) has the molecular formula C16H21FN6 and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-methyl-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-methyl-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165836 |
| Molecular Formula | C16H21FN6 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-methyl-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccn[nH]1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H21FN6/c1-18-16(19-12-14-6-7-20-21-14)23-10-8-22(9-11-23)15-4-2-13(17)3-5-15/h2-7H,8-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | YQQRMJCFRHXYGN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|