C23H27FN6 — CID 111165661
4-(4-fluorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111165661) has the molecular formula C23H27FN6 and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165661 |
| Molecular Formula | C23H27FN6 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H27FN6/c1-25-23(30-13-11-29(12-14-30)22-7-5-21(24)6-8-22)27-16-19-3-2-4-20(15-19)17-28-10-9-26-18-28/h2-10,15,18H,11-14,16-17H2,1H3,(H,25,27) |
| InChIKey | CJPZJBKRGWKVTK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|