C25H28FN5O2 — CID 111164997
3-[[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 111164997) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111164997 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-[[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | C/N=C(\NCc1cccc(C(=O)NCc2ccco2)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H28FN5O2/c1-27-25(31-13-11-30(12-14-31)22-9-7-21(26)8-10-22)29-17-19-4-2-5-20(16-19)24(32)28-18-23-6-3-15-33-23/h2-10,15-16H,11-14,17-18H2,1H3,(H,27,29)(H,28,32) |
| InChIKey | JLNMXVVMDCLJJB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|