C24H33N5O — CID 110961855
N-tert-butyl-3-[[[N-methyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]methyl]benzamide (PubChem CID 110961855) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is N-tert-butyl-3-[[[N-methyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[[N-methyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110961855 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N-tert-butyl-3-[[[N-methyl-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1cccc(C(=O)NC(C)(C)C)c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N5O/c1-24(2,3)27-22(30)20-10-8-9-19(17-20)18-26-23(25-4)29-15-13-28(14-16-29)21-11-6-5-7-12-21/h5-12,17H,13-16,18H2,1-4H3,(H,25,26)(H,27,30) |
| InChIKey | MCDVFWUFLKVSKO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|