C20H27N5O2S — CID 110960955
N'-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide (PubChem CID 110960955) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is N'-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110960955 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N'-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(S(=O)(=O)NC)c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N5O2S/c1-21-20(23-16-17-7-6-10-19(15-17)28(26,27)22-2)25-13-11-24(12-14-25)18-8-4-3-5-9-18/h3-10,15,22H,11-14,16H2,1-2H3,(H,21,23) |
| InChIKey | UOHKSMFZOFBVGH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|