C23H28ClIN6 — CID 111177691
4-(2-chlorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111177691) has the molecular formula C23H28ClIN6 and a molecular weight of 550.88 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-chlorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111177691 |
| Molecular Formula | C23H28ClIN6 |
| Molecular Weight | 550.88 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2)c1)N1CCN(c2ccccc2Cl)CC1.I |
| InChI | InChI=1S/C23H27ClN6.HI/c1-25-23(30-13-11-29(12-14-30)22-8-3-2-7-21(22)24)27-16-19-5-4-6-20(15-19)17-28-10-9-26-18-28;/h2-10,15,18H,11-14,16-17H2,1H3,(H,25,27);1H |
| InChIKey | LZFQXCJMERFTRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|