C21H25ClFN5O — CID 111165221
2-chloro-N-[2-[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]benzamide (PubChem CID 111165221) has the molecular formula C21H25ClFN5O and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-chloro-N-[2-[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111165221 |
| Molecular Formula | C21H25ClFN5O |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-chloro-N-[2-[[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1Cl)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25ClFN5O/c1-24-21(26-11-10-25-20(29)18-4-2-3-5-19(18)22)28-14-12-27(13-15-28)17-8-6-16(23)7-9-17/h2-9H,10-15H2,1H3,(H,24,26)(H,25,29) |
| InChIKey | IMHXSYJWMKAPMJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|