C20H24FN7 — CID 111165501
4-(4-fluorophenyl)-N'-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111165501) has the molecular formula C20H24FN7 and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165501 |
| Molecular Formula | C20H24FN7 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24FN7/c1-22-20(23-10-9-19-25-24-18-4-2-3-11-28(18)19)27-14-12-26(13-15-27)17-7-5-16(21)6-8-17/h2-8,11H,9-10,12-15H2,1H3,(H,22,23) |
| InChIKey | GNXTWSGZRDQUJV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|