C19H30N6 — CID 111743953
N'-methyl-3-pentan-3-yl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111743953) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is N'-methyl-3-pentan-3-yl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-pentan-3-yl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743953 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N'-methyl-3-pentan-3-yl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCC(CC)C1CCN(/C(=N\C)NCCc2nnc3ccccn23)C1 |
| InChI | InChI=1S/C19H30N6/c1-4-15(5-2)16-10-13-24(14-16)19(20-3)21-11-9-18-23-22-17-8-6-7-12-25(17)18/h6-8,12,15-16H,4-5,9-11,13-14H2,1-3H3,(H,20,21) |
| InChIKey | XPNQOPMWXXODDM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|