C22H28N6O — CID 109425880
N'-methyl-4-phenoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide (PubChem CID 109425880) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is N'-methyl-4-phenoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-phenoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109425880 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N'-methyl-4-phenoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N6O/c1-23-22(24-14-7-11-21-26-25-20-10-5-6-15-28(20)21)27-16-12-19(13-17-27)29-18-8-3-2-4-9-18/h2-6,8-10,15,19H,7,11-14,16-17H2,1H3,(H,23,24) |
| InChIKey | HTBAEAHQMUZRJP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|