C24H30N4O — CID 109427030
N-[3-(1H-indol-3-yl)propyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109427030) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)propyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N-[3-(1H-indol-3-yl)propyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427030 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N-[3-(1H-indol-3-yl)propyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N4O/c1-25-24(26-15-7-8-19-18-27-23-12-6-5-11-22(19)23)28-16-13-21(14-17-28)29-20-9-3-2-4-10-20/h2-6,9-12,18,21,27H,7-8,13-17H2,1H3,(H,25,26) |
| InChIKey | RJIDRHOMIBYLRT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|