C23H28N4 — CID 111724485
3-benzyl-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111724485) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 3-benzyl-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724485 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-benzyl-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N4/c1-24-23(25-13-11-20-16-26-22-10-6-5-9-21(20)22)27-14-12-19(17-27)15-18-7-3-2-4-8-18/h2-10,16,19,26H,11-15,17H2,1H3,(H,24,25) |
| InChIKey | MSCVGVSXUGLSEJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|