C17H26N6S — CID 109488039
N',2,2-trimethyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]thiomorpholine-4-carboximidamide (PubChem CID 109488039) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488039 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N',2,2-trimethyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H26N6S/c1-17(2)13-22(11-12-24-17)16(18-3)19-9-6-8-15-21-20-14-7-4-5-10-23(14)15/h4-5,7,10H,6,8-9,11-13H2,1-3H3,(H,18,19) |
| InChIKey | SJVXZUZYMMIKJU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|