C19H22N6 — CID 111723451
N'-methyl-3-phenyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111723451) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is N'-methyl-3-phenyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-phenyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723451 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N'-methyl-3-phenyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H22N6/c1-20-19(21-13-18-23-22-17-9-5-6-11-25(17)18)24-12-10-16(14-24)15-7-3-2-4-8-15/h2-9,11,16H,10,12-14H2,1H3,(H,20,21) |
| InChIKey | VIYLIDBJIIAJHL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|