C20H24N6S — CID 111748814
N'-methyl-3-(phenylsulfanylmethyl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111748814) has the molecular formula C20H24N6S and a molecular weight of 380.52 g/mol. Its IUPAC name is N'-methyl-3-(phenylsulfanylmethyl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(phenylsulfanylmethyl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748814 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N'-methyl-3-(phenylsulfanylmethyl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N6S/c1-21-20(22-13-19-24-23-18-9-5-6-11-26(18)19)25-12-10-16(14-25)15-27-17-7-3-2-4-8-17/h2-9,11,16H,10,12-15H2,1H3,(H,21,22) |
| InChIKey | IBCMJBVKRDYSQE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|