C18H24N4S2 — CID 119145438
N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 119145438) has the molecular formula C18H24N4S2 and a molecular weight of 360.55 g/mol. Its IUPAC name is N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119145438 |
| Molecular Formula | C18H24N4S2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nc(C)cs1)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C18H24N4S2/c1-14-12-24-17(21-14)10-20-18(19-2)22-9-8-15(11-22)13-23-16-6-4-3-5-7-16/h3-7,12,15H,8-11,13H2,1-2H3,(H,19,20) |
| InChIKey | RDJGHIFSAQFZAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|