C18H25N5S — CID 119145426
N'-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 119145426) has the molecular formula C18H25N5S and a molecular weight of 343.50 g/mol. Its IUPAC name is N'-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119145426 |
| Molecular Formula | C18H25N5S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N'-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cn[nH]c1C)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C18H25N5S/c1-14-16(11-21-22-14)10-20-18(19-2)23-9-8-15(12-23)13-24-17-6-4-3-5-7-17/h3-7,11,15H,8-10,12-13H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | ZDVVAAGAASKDJX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|