C23H31N7 — CID 111414536
1,2-dimethyl-1-[(4-piperidin-1-ylphenyl)methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111414536) has the molecular formula C23H31N7 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(4-piperidin-1-ylphenyl)methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(4-piperidin-1-ylphenyl)methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111414536 |
| Molecular Formula | C23H31N7 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 1,2-dimethyl-1-[(4-piperidin-1-ylphenyl)methyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)N(C)Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H31N7/c1-24-23(25-14-13-22-27-26-21-8-4-7-17-30(21)22)28(2)18-19-9-11-20(12-10-19)29-15-5-3-6-16-29/h4,7-12,17H,3,5-6,13-16,18H2,1-2H3,(H,24,25) |
| InChIKey | LMSOXPIKLZMALS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|