C18H21Cl2IN6 — CID 111306136
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111306136) has the molecular formula C18H21Cl2IN6 and a molecular weight of 519.22 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306136 |
| Molecular Formula | C18H21Cl2IN6 |
| Molecular Weight | 519.22 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H20Cl2N6.HI/c1-21-18(25(2)12-13-6-7-14(19)15(20)11-13)22-9-8-17-24-23-16-5-3-4-10-26(16)17;/h3-7,10-11H,8-9,12H2,1-2H3,(H,21,22);1H |
| InChIKey | WMYIBDVDJJNIKQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|