C21H29IN6 — CID 111283160
3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111283160) has the molecular formula C21H29IN6 and a molecular weight of 492.41 g/mol. Its IUPAC name is 3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111283160 |
| Molecular Formula | C21H29IN6 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N(C)Cc1ccc(CC)cc1.I |
| InChI | InChI=1S/C21H28N6.HI/c1-4-17-9-11-18(12-10-17)16-26(3)21(22-5-2)23-14-13-20-25-24-19-8-6-7-15-27(19)20;/h6-12,15H,4-5,13-14,16H2,1-3H3,(H,22,23);1H |
| InChIKey | FIATZRQNFXMDFJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|