C22H27IN8 — CID 111414658
3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111414658) has the molecular formula C22H27IN8 and a molecular weight of 530.42 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111414658 |
| Molecular Formula | C22H27IN8 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N(C)Cc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C22H26N8.HI/c1-3-23-22(24-13-12-21-27-26-20-11-7-8-14-29(20)21)28(2)16-18-15-25-30(17-18)19-9-5-4-6-10-19;/h4-11,14-15,17H,3,12-13,16H2,1-2H3,(H,23,24);1H |
| InChIKey | WRBFHIDKJQZVKO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|