C19H26F3IN6O — CID 111501690
2-[[ethylamino-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111501690) has the molecular formula C19H26F3IN6O and a molecular weight of 538.36 g/mol. Its IUPAC name is 2-[[ethylamino-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111501690 |
| Molecular Formula | C19H26F3IN6O |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 2-[[ethylamino-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)N(C)Cc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C19H25F3N6O.HI/c1-4-23-18(24-11-17(29)27(3)14-19(20,21)22)26(2)12-15-10-25-28(13-15)16-8-6-5-7-9-16;/h5-10,13H,4,11-12,14H2,1-3H3,(H,23,24);1H |
| InChIKey | UOYISMMGHXZPGF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|