C20H24ClN5OS — CID 111502801
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 111502801) has the molecular formula C20H24ClN5OS and a molecular weight of 417.97 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111502801 |
| Molecular Formula | C20H24ClN5OS |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N(C)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H24ClN5OS/c1-3-22-20(23-12-17(27)18-9-10-19(21)28-18)25(2)13-15-11-24-26(14-15)16-7-5-4-6-8-16/h4-11,14,17,27H,3,12-13H2,1-2H3,(H,22,23) |
| InChIKey | XJZOOBZVFYATPZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|