C16H16ClN3OS — CID 111469606
1-(5-chlorothiophen-2-yl)-2-[(1-phenylpyrazol-4-yl)methylamino]ethanol (PubChem CID 111469606) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-[(1-phenylpyrazol-4-yl)methylamino]ethanol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-[(1-phenylpyrazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 111469606 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-[(1-phenylpyrazol-4-yl)methylamino]ethanol |
| SMILES | OC(CNCc1cnn(-c2ccccc2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H16ClN3OS/c17-16-7-6-15(22-16)14(21)10-18-8-12-9-19-20(11-12)13-4-2-1-3-5-13/h1-7,9,11,14,18,21H,8,10H2 |
| InChIKey | QSFNSDUBZVKJCI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |