C19H25ClN4OS — CID 111493476
N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide (PubChem CID 111493476) has the molecular formula C19H25ClN4OS and a molecular weight of 392.96 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111493476 |
| Molecular Formula | C19H25ClN4OS |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25ClN4OS/c1-2-21-19(22-14-16(25)17-8-9-18(20)26-17)24-12-10-23(11-13-24)15-6-4-3-5-7-15/h3-9,16,25H,2,10-14H2,1H3,(H,21,22) |
| InChIKey | XWKXADJLPFSQHQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|