C18H29ClIN5O2S — CID 111502686
2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide (PubChem CID 111502686) has the molecular formula C18H29ClIN5O2S and a molecular weight of 541.89 g/mol. Its IUPAC name is 2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide.
| Compound Name | 2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111502686 |
| Molecular Formula | C18H29ClIN5O2S |
| Molecular Weight | 541.89 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | 2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N1CCN(CC(=O)NC2CC2)CC1.I |
| InChI | InChI=1S/C18H28ClN5O2S.HI/c1-2-20-18(21-11-14(25)15-5-6-16(19)27-15)24-9-7-23(8-10-24)12-17(26)22-13-3-4-13;/h5-6,13-14,25H,2-4,7-12H2,1H3,(H,20,21)(H,22,26);1H |
| InChIKey | YRQGLFDSIVMHFQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.89 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|