C18H30ClN5O2S — CID 111502545
2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 111502545) has the molecular formula C18H30ClN5O2S and a molecular weight of 415.99 g/mol. Its IUPAC name is 2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 111502545 |
| Molecular Formula | C18H30ClN5O2S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[4-[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N1CCN(CC(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C18H30ClN5O2S/c1-4-20-18(21-11-14(25)15-5-6-16(19)27-15)24-9-7-23(8-10-24)12-17(26)22-13(2)3/h5-6,13-14,25H,4,7-12H2,1-3H3,(H,20,21)(H,22,26) |
| InChIKey | KOAGUHHARPBMDG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|