C19H26ClIN4O2S — CID 111502038
N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111502038) has the molecular formula C19H26ClIN4O2S and a molecular weight of 536.87 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111502038 |
| Molecular Formula | C19H26ClIN4O2S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C19H25ClN4O2S.HI/c1-2-21-19(22-13-16(26)17-7-8-18(20)27-17)24-11-9-23(10-12-24)14-5-3-4-6-15(14)25;/h3-8,16,25-26H,2,9-13H2,1H3,(H,21,22);1H |
| InChIKey | SFKDQJJYMVVVPY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|