C21H31N5OS — CID 111186202
N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 111186202) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186202 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(c1cccs1)N(C)C)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C21H31N5OS/c1-4-22-21(23-16-18(24(2)3)20-10-7-15-28-20)26-13-11-25(12-14-26)17-8-5-6-9-19(17)27/h5-10,15,18,27H,4,11-14,16H2,1-3H3,(H,22,23) |
| InChIKey | CGGTZYUKDHVPII-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|