C18H31N5O2S — CID 111164639
ethyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164639) has the molecular formula C18H31N5O2S and a molecular weight of 381.55 g/mol. Its IUPAC name is ethyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164639 |
| Molecular Formula | C18H31N5O2S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | ethyl 4-[N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CC(c1cccs1)N(C)C)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H31N5O2S/c1-5-19-17(20-14-15(21(3)4)16-8-7-13-26-16)22-9-11-23(12-10-22)18(24)25-6-2/h7-8,13,15H,5-6,9-12,14H2,1-4H3,(H,19,20) |
| InChIKey | YFTJMJSJFFDKIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|