C13H19N3O3S — CID 115286815
ethyl 4-(2-amino-2-thiophen-2-ylacetyl)piperazine-1-carboxylate (PubChem CID 115286815) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl 4-(2-amino-2-thiophen-2-ylacetyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-amino-2-thiophen-2-ylacetyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 115286815 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 4-(2-amino-2-thiophen-2-ylacetyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(N)c2cccs2)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-2-19-13(18)16-7-5-15(6-8-16)12(17)11(14)10-4-3-9-20-10/h3-4,9,11H,2,5-8,14H2,1H3 |
| InChIKey | QCRZIBVHFYWOGJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |