C11H16N2OS2 — CID 115287048
2-amino-1-(1,4-thiazepan-4-yl)-2-thiophen-2-ylethanone (PubChem CID 115287048) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-amino-1-(1,4-thiazepan-4-yl)-2-thiophen-2-ylethanone.
| Compound Name | 2-amino-1-(1,4-thiazepan-4-yl)-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 115287048 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-amino-1-(1,4-thiazepan-4-yl)-2-thiophen-2-ylethanone |
| SMILES | NC(C(=O)N1CCCSCC1)c1cccs1 |
| InChI | InChI=1S/C11H16N2OS2/c12-10(9-3-1-7-16-9)11(14)13-4-2-6-15-8-5-13/h1,3,7,10H,2,4-6,8,12H2 |
| InChIKey | BFWNAICVEGORDM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |