C13H16N4O3S — CID 115287620
9-(2-amino-2-thiophen-2-ylacetyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 115287620) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 9-(2-amino-2-thiophen-2-ylacetyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-(2-amino-2-thiophen-2-ylacetyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 115287620 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 9-(2-amino-2-thiophen-2-ylacetyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | NC(C(=O)N1CCCC2(C1)NC(=O)NC2=O)c1cccs1 |
| InChI | InChI=1S/C13H16N4O3S/c14-9(8-3-1-6-21-8)10(18)17-5-2-4-13(7-17)11(19)15-12(20)16-13/h1,3,6,9H,2,4-5,7,14H2,(H2,15,16,19,20) |
| InChIKey | HJWADRKRSUHTKV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|