C12H16N2O3S2 — CID 115287462
2-[4-(2-amino-2-thiophen-2-ylacetyl)thiomorpholin-3-yl]acetic acid (PubChem CID 115287462) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[4-(2-amino-2-thiophen-2-ylacetyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2-amino-2-thiophen-2-ylacetyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 115287462 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[4-(2-amino-2-thiophen-2-ylacetyl)thiomorpholin-3-yl]acetic acid |
| SMILES | NC(C(=O)N1CCSCC1CC(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H16N2O3S2/c13-11(9-2-1-4-19-9)12(17)14-3-5-18-7-8(14)6-10(15)16/h1-2,4,8,11H,3,5-7,13H2,(H,15,16) |
| InChIKey | VOEBUKJBSSDNAS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |